6-chloro-purine-9-b-D-(2-O-acetyl-3,5-di-O-benzoyl)xylo-furanoside
6-Chloro-purine-9-b-D-(2-O-acetyl-3,5-di-O-benzoyl)xylo-furanoside is a biomedical compound used in the research of certain diseases. This compound possesses potential antiviral properties and is utilized in drug development against viral infections. It serves as a key component for the research and development of specific medications targeting viral diseases aiding in the development of biomedical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 132370-61-7 |
| Pricing | Inquire |
| Cas | 132370-61-7 |
| Molecular Weight | 536.92 |
| Molecular Formula | C26H21ClN4O7 |
| Canonical SMILES | CC(=O)OC1C(C(OC1N2C=NC3=C2N=CN=C3Cl)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |