2'-O-Acetyl-5'-O-(p-toluoyl)-3'-deoxy-3'-fluoro-5-methoxyluridine
2'-O-Acetyl-5'-O-(p-toluoyl)-3'-deoxy-3'-fluoro-5-methoxyluridine, a compound of utmost significance in the biomedical sphere, serves as a potent therapeutic tool against the pernicious realm of viral ailments. Its efficacy as an antiviral agent propels it into a realm of momentous potential, birthing possibilities for revolutionary antiviral medications. Thorough scientific inquiry has unveiled its capacity to combat a multiplicity of viruses, mere instances including influenza and herpes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2072145-81-2 |
| Pricing | Inquire |
| Cas | 2072145-81-2 |
| Molecular Weight | 436.39 |
| Molecular Formula | C20H21FN2O8 |
| Canonical SMILES | CC1=CC=CC=C1C(=O)C(C2C(C(C(O2)N3C=C(C(=O)NC3=O)OC)OC(=O)C)F)O |