D-Ribose-5-phosphate disodium salt hydrate
D-Ribose-5-phosphate disodium salt hydrate is a pivotal biomolecule extensively utilized in the biomedical sector, showcasing remarkable enzymatic attributes while serving as a pivotal participant in nucleotide and nucleic acid biosynthesis. It finds extensive application as a precursor in DNA and RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18265-46-8 |
| Pricing | Inquire |
| Cas | 18265-46-8 |
| Molecular Weight | 274.07 |
| Molecular Formula | C5H9Na2O8P H2O |
| Canonical SMILES | C(C(C(C(C=O)[O-])[O-])O)OP(=O)(O)O.[Na+].[Na+] |