5-BROMO-2-FLUORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]-DIOXABOROLAN-2-YL)PYRIDINE
5-Bromo-2-fluoro-3-(4,4,5,5-tetramethyl-[1,3,2]-dioxaborolan-2-yl)pyridine is a prevalent compound within the biomedical realm and exhibits substantial utilization. Its application resides in the advancement of pharmaceutical medications targeting precise maladies. With its distinctive chemical framework, this compound showcases paramount therapeutic outcomes, thus rendering it indispensable in addressing an array of afflictions and circumstances.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1073353-50-0 |
| Pricing | Inquire |
| Cas | 1073353-50-0 |
| Molecular Weight | 301.947763 |
| Molecular Formula | C11H14BBrFNO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2F)Br |