3-(Ethoxycarbonyl)-4-methyl-2-furanpropanoic Acid Ethyl Ester
3-(Ethoxycarbonyl)-4-methyl-2-furanpropanoic Acid Ethyl Ester is an intermediate in the synthesis of CMPF (C595002), a drug-binding inhibitor which is also a constituent of urine. CMPF can inhibit specific T4 binding in serum by increasing the free concentration of direct competitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB066010 |
| Pricing | Inquire |
| Cas | 181866-83-1 |
| Molecular Weight | 254.28 |
| Molecular Formula | C13H18O5 |
| Canonical SMILES | CCOC(=O)CCC1=C(C(=CO1)C)C(=O)OCC |