Lewis B tetrasaccharide
Lewis B tetrasaccharide is a remarkable bioactive oligosaccharide, widely employed in the biomedical field. Functioning as a selectin protein ligand, Lewis B tetrasaccharide exerts its effect by impeding leukocyte adhesion, effectively used for studying the inflammatory response associated with inflammatory bowel disease (IBD).
| Supplier | BOC Sciences |
|---|---|
| Product # | 80081-06-7 |
| Pricing | Inquire |
| Cas | 80081-06-7 |
| Molecular Weight | 675.63 |
| Molecular Formula | C26H45NO19 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)C)O)O)O)NC(=O)C)O)CO)O)O)O |