Cyanocobalamin-b-carboxylic Acid
Cyancobalamin-b-carboxylic Acid is a Vitamin B12 derivative, which is a water-soluble vitamin with a key role in the normal functioning of the brain and nervous system, and for the formation of blood.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38218-77-8 |
| Pricing | Inquire |
| Cas | 38218-77-8 |
| Molecular Weight | 1356.35 |
| Molecular Formula | C63H87CoN13O15P |
| Canonical SMILES | CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)([O-])OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=N6)C(=C7C(C(C(=N7)C=C8C(C(C(=N8)C(=C4[N-]5)C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)C)CCC(=O)O)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+3] |