methyl 2,3,5-tris-O-(2,4-dichlorobenzyl)-D-ribofuranoside

Methyl 2,3,5-tris-O-(2,4-dichlorobenzyl)-D-ribofuranoside is a highly complex chemical compound that exhibits significant potential as an antiviral agent. It is currently undergoing extensive scientific research for its possible application in treating viral infections including HIV and hepatitis B. Recent studies have highlighted its inhibitory properties in relation to viral replication, thereby positioning it as a highly promising candidate for future drug development. The intricate molecular structure of this chemical compound has captured the attention of scientists as a potential breakthrough in the fight against viral diseases.
Supplier BOC Sciences
Product # 677299-16-0
Pricing Inquire
Cas 677299-16-0
Molecular Weight 641.19
Molecular Formula C27H24Cl6O5
Canonical SMILES COC1C(C(C(O1)COCC2=C(C=C(C=C2)Cl)Cl)OCC3=C(C=C(C=C3)Cl)Cl)OCC4=C(C=C(C=C4)Cl)Cl
Feedback