Betamethasone 21-acetate
Betamethasone 21-acetate, a synthetic glucocorticoid, plays a pivotal role in treating a spectrum of inflammatory skin conditions, allergic disorders, and specific autoimmune diseases. Its multifaceted therapeutic applications extend to the management of diverse cancers and harnessing immunosuppressive prowess in organ transplant recipients.
| Supplier | BOC Sciences |
|---|---|
| Product # | 987-24-6 |
| Pricing | Inquire |
| Cas | 987-24-6 |
| Molecular Weight | 434.5 |
| Molecular Formula | C24H31FO6 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)O)C)O)F)C |