D-Glucose diethyl mercaptal
D-Glucose diethyl mercaptal, an essential reagent in the synthesis of numerous biomedicinal compounds, exhibits remarkable potential in the regulation of blood glucose levels, rendering it a sought-after compound in the development of anti-diabetic drugs. Its versatile applications, however, extend far beyond diabetic research, encompassing innovative investigations of glycosylation, a process implicated in the pathology of multiple chronic conditions including Alzheimer's and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1941-52-2 |
| Pricing | Inquire |
| Cas | 1941-52-2 |
| Molecular Weight | 286.41 |
| Molecular Formula | C10H22O5S2 |
| Canonical SMILES | CCSC(C(C(C(C(CO)O)O)O)O)SCC |