2'-Deoxyuridine 5'-triphosphate monosodium salt
2'-Deoxyuridine 5'-triphosphate monosodium salt is a modified nucleotide, acting as a substrate for DNA polymerases during DNA research and development. Its utilization enables the incorporation of dideoxynucleotides for chain termination sequencing reactions, making it crucial for DNA sequencing and site-directed mutagenesis studies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6152-08-5 |
| Pricing | Inquire |
| Cas | 6152-08-5 |
| Molecular Weight | 491.13 |
| Molecular Formula | C9H15N2O14P3.Na |
| Canonical SMILES | [Na].O=C1C=CN(C(=O)N1)C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2 |