Biotin-sar-oh
Biotin-sar-oh is a cleavable linker widely used in conjugated drug development. It has ultra-modern applicability as a targeted therapeutic adjunct that selectively binds to malignant cellular entities and strongly inhibits their proliferative activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-002348 |
| Pricing | Inquire |
| Cas | 154024-76-7 |
| Molecular Weight | 315.39 |
| Molecular Formula | C13H21N3O4S |
| Canonical SMILES | CN(CC(=O)O)C(=O)CCCCC1C2C(CS1)NC(=O)N2 |