2',3'-Di-O-acetyladenoside
2',3'-Di-O-acetyladenoside is a modified nucleoside frequently used in the biomedicine industry. It offers potential as a therapeutic agent in the research of viral diseases and cancers by inhibiting the functions of certain proteins and enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29886-19-9 |
| Pricing | Inquire |
| Cas | 29886-19-9 |
| Molecular Weight | 351.31 |
| Molecular Formula | C14H17N5O6 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC(=O)C)N2C=NC3=C(N=CN=C32)N)CO |