Quinoline-6-boronic acid, pinacol ester
Quinoline-6-boronic acid, pinacol ester is a vital compound in biomedicine and is utilized in the development of various drugs targeting diseases like cancer, diabetes, and infections. This product plays a crucial role as a building block in the synthesis of therapeutic agents that aim to combat these conditions, contributing to advancements in the biomedical field.
| Supplier | BOC Sciences |
|---|---|
| Product # | 406463-06-7 |
| Pricing | Inquire |
| Cas | 406463-06-7 |
| Molecular Weight | 255.12 |
| Molecular Formula | C15H18BNO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CC=C3 |