Janelia Fluor 646, SE
Janelia Fluor 646, SE is a red fluorescent dye containing an NHS ester that can be conjugated with primary amine groups. It is suitable for live cell imaging.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1811539-59-9 |
| Pricing | Inquire |
| Cas | 1811539-59-9 |
| Molecular Weight | 593.71 |
| Molecular Formula | C33H31N3O6Si |
| Canonical SMILES | C[Si]1(C2=CC(=[N+]3CCC3)C=CC2=C(C4=C1C=C(C=C4)N5CCC5)C6=C(C=CC(=C6)C(=O)ON7C(=O)CCC7=O)C(=O)[O-])C |