2',3',5'-Tri-O-acetyl-2N,2N-dimethyl Guanosine
2',3',5'-Tri-O-acetyl-2N,2N-dimethyl Guanosine, a formidable biomedicine compound, unveils its unparalleled chemical prowess in combatting a myriad of afflictions. Unlocking a gateway to triumph over drug-resistant pathogenic strains and select neoplastic manifestations, it emerges as an innovative therapeutic prospect.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73196-87-9 |
| Pricing | Inquire |
| Cas | 73196-87-9 |
| Molecular Weight | 437.4 |
| Molecular Formula | C18H23N5O8 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C2N=C(NC3=O)N(C)C)OC(=O)C)OC(=O)C |