N-Desmethyl-4-hydroxy Tamoxifen-[d5] (E/Z Mixture)
N-Desmethyl-4-hydroxy Tamoxifen-[d5] (E/Z Mixture) is the labelled analogue of N-Desmethyl-4-hydroxy Tamoxifen (E/Z Mixture), which is an impurity of Tamoxifen. Tamoxifen is an estrogen response modifier as well as protein kinase C inhibitor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1584173-54-5 |
| Pricing | Inquire |
| Cas | 1584173-54-5 |
| Molecular Weight | 378.52 |
| Molecular Formula | C25H22D5NO2 |
| Canonical SMILES | CCC(=C(C1=CC=C(C=C1)O)C2=CC=C(C=C2)OCCNC)C3=CC=CC=C3 |