Mps1-IN-5
Mps1-IN-5, also called as BAY1161909, a derivative of triazolopyridine, is an inhibitor of Mps1 kinase (IC50< 10 nmol/L) and in combination with antimitotic cancer drugs it can enhance their efficacy and potentially overcome resistance.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1443763-60-7 |
| Pricing | Inquire |
| Cas | 1443763-60-7 |
| Molecular Weight | 559.61 |
| Molecular Formula | C29H26FN5O4S |
| Canonical SMILES | CC(C1=CC=C(C=C1)F)C(=O)NC2=CC=C(C=C2)C3=CN4C(=NC(=N4)NC5=C(C=C(C=C5)S(=O)(=O)C)OC)C=C3 |