6-Thio-9-(b-D-arabinofuranosyl)purine
6-Thio-9-(b-D-arabinofuranosyl)purine, also known as 6-TG, is a prominent biomedicine applied extensively for treating a wide range of ailments. Renowned for its superior antimetabolite properties, this compound effectively hampers DNA synthesis, impeding the uncontrolled growth of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 892-49-9 |
| Pricing | Inquire |
| Cas | 892-49-9 |
| Molecular Weight | 284.29 |
| Molecular Formula | C10H12N4O4S |
| Canonical SMILES | C1=NC(=S)C2=C(N1)N(C=N2)C3C(C(C(O3)CO)O)O |