CX-4945 sodium salt
CX-4945 (Silmitasertib) sodium salt is a potent and selective ATP-competitive small molecule protein kinase CK2 inhibitor with a Ki and an IC50 of 0.38 and 1 nM for recombinant human CK2α, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1309357-15-0 |
| Pricing | Inquire |
| Cas | 1309357-15-0 |
| Molecular Weight | 371.75 |
| Molecular Formula | C19H11ClN3NaO2 |
| Canonical SMILES | C1=CC(=CC(=C1)Cl)NC2=C3C=CN=CC3=C4C=CC(=CC4=N2)C(=O)O.[Na] |