Deracoxib-[d4]
Deracoxib-[d4], is the labelled analogue of Deracoxib. Deracoxib is a nonsteroidal anti-inflammatory drug of the coxib class, used in dogs to treat pain associated with osteoarthritis, or to prevent pain following orthopedic or dental surgery.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002489 |
| Pricing | Inquire |
| Cas | 1794780-24-7 |
| Molecular Weight | 401.4 |
| Molecular Formula | C17H10D4F3N3O3S |
| Canonical SMILES | COC1=C(C=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)F)F |