Ethyl 2,3,4,6-tetra-O-benzoyl-b-D-thiogalactopyranoside
Ethyl 2,3,4,6-tetra-O-benzoyl-b-D-thiogalactopyranoside is a valuable compound acting as a crucial substrate for various enzymatic assays and biochemical research studies. It is specifically employed in the development and investigation of drug candidates targeting galactosyltransferase enzymes. Furthermore, this compound can be utilized as a synthetic intermediate in the synthesis of carbohydrate-based drugs for studying diseases such as cancer and infectious disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138661-53-7 |
| Pricing | Inquire |
| Cas | 138661-53-7 |
| Molecular Weight | 640.7 |
| Molecular Formula | C36H32O9S |
| Canonical SMILES | CCSC1C(C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |