3-Azido-2,3-dideoxy-D-ribose
3-Azido-2,3-dideoxy-D-ribose is an indispensable constituent employed within the biomedical field, finding utility in the research and development of antiviral pharmaceuticals. Its effectiveness pervades the research landscape of viral afflictions, encompassing the likes of HIV/AIDS and an array of other viral maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138168-21-5 |
| Pricing | Inquire |
| Cas | 138168-21-5 |
| Molecular Weight | 159.14 |
| Molecular Formula | C5H9N3O3 |
| Canonical SMILES | C(C=O)C(C(CO)O)N=[N+]=[N-] |