18:1 Lactosyl PE (ammonium salt)
18:1 Lactosyl PE (ammonium salt) serves as a vital component within drug delivery mechanisms utilized for precise cancer therapy and treatment of various ailments. Its remarkable attribute lies in its capacity to amplify the effectiveness of anti-neoplastic agents by selectively homing in on malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 474943-47-0 |
| Pricing | Inquire |
| Cas | 474943-47-0 |
| Molecular Weight | 1087.36 |
| Molecular Formula | C53H103N2O18P |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCCNCC(C(C(C(CO)O)OC1C(C(C(C(O1)CO)O)O)O)O)O)OC(=O)CCCCCCCC=CCCCCCCCC.[NH4+] |