D-(+)-Darunavir
D-(+)-Darunavir is a highly efficacious antiretroviral compound, demonstrating compelling utility in studying HIV-1 infection. By impeding the viral protease enzyme, its pharmacological action effectively averts the fragmentation of viral polyproteins, thereby decisively impeding viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1399859-60-9 |
| Pricing | Inquire |
| Cas | 1399859-60-9 |
| Molecular Weight | 547.66 |
| Molecular Formula | C27H37N3O7S |
| Canonical SMILES | CC(C)CN(CC(C(CC1=CC=CC=C1)NC(=O)OC2COC3C2CCO3)O)S(=O)(=O)C4=CC=C(C=C4)N |