5-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinonitrile
5-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinonitrile is a remarkable and intricate biomedicine chemical that manifests its profound impact by proficiently hindering designated enzymes implicated in fundamental cellular processes. Through its formidable inhibition, it holds immense potential in serving as a therapeutic avenue for afflictions that warrant targeted interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1247726-68-6 |
| Pricing | Inquire |
| Cas | 1247726-68-6 |
| Molecular Weight | 260.1 |
| Molecular Formula | C13H17BN2O3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2C#N)OC |