5'-DMT-2'-O-MOE-G(iBu)-3'-PS-Phosphoramidite
5'-DMT-2'-O-MOE-G(iBu)-3'-PS-Phosphoramidite is a specialized nucleotide used in oligonucleotide synthesis. It features a dimethoxytrityl (DMT) protecting group at the 5' position, a 2'-O-methoxyethyl (MOE) modification on the ribose sugar, and a guanine base modified with an isobutyl (iBu) group. Additionally, it incorporates a phosphorothioate (PS) linkage at the 3' position. This phosphoramidite facilitates controlled addition during synthesis and provides enhanced stability and resistance to nuclease degradation in oligonucleotide sequences. It is utilized in various molecular biology research applications, including gene synthesis, RNA interference, and nucleic acid probe development.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00405 |
| Pricing | Inquire |
| Cas | 2360826-78-2 |
| Molecular Weight | 1011.16 |
| Molecular Formula | C51H59N6O10PS2 |
| Canonical SMILES | O=C1N=C(NC(=O)C(C)C)NC2=C1N=CN2C3OC(COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6)C(OP(SCCSC(=O)C=7C=CC=CC7)N8CCCC8)C3OCCOC |