(β-Asp5)-delta-Sleep Inducing Peptide
(β-Asp5)-delta-Sleep Inducing Peptide, a DSIP analog, is a good substrate for the protein L-isoaspartyl methyltransferase, an enzyme occuring in the brain involved in repairing age-damaged proteins containing atypical iosaspartyl peptide bonds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82602-88-8 |
| Pricing | Inquire |
| Cas | 82602-88-8 |
| Molecular Weight | 848.81 |
| Molecular Formula | C35H48N10O15 |
| Canonical SMILES | CC(C(=O)NC(CO)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)O)NC(=O)CC(C(=O)O)NC(=O)CNC(=O)CNC(=O)C(C)NC(=O)C(CC1=CNC2=CC=CC=C21)N |