Palustric acid
Palustric acid is a bioactive substance found in nature. Extensive investigations have elucidated its remarkable anti-inflammatory attributes, rendering it an auspicious contender for studying the effects of inflammatory ailments like arthritis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1945-53-5 |
| Pricing | Inquire |
| Cas | 1945-53-5 |
| Molecular Weight | 302.45 |
| Molecular Formula | C20H30O2 |
| Canonical SMILES | CC(C)C1=CC2=C(CC1)C3(CCCC(C3CC2)(C)C(=O)O)C |