Cefalonium Impurity B
Deacetylcephalothin is an impurity in the synthesis of Cefalonium and an analog of Cephalothin a first-generation cephalosporin antibiotic used as a long-acting intramammary cerate for infusion of dairy cows.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5935-65-9 |
| Pricing | Inquire |
| Cas | 5935-65-9 |
| Molecular Weight | 354.41 |
| Molecular Formula | C14H14N2O5S2 |
| Canonical SMILES | C1C(=C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CS3)C(=O)O)CO |