Pseudolaric acid B
Pseudolaric acid B (PAB), which comes from the bark of Pseudolarix kaempferi Gordon, has diverse effects that are relevant to cancer therapy, including apoptosis of cancer cells (IC50 = ~1 μM), preventing angiogenesis, and inhibiting tumor growth in vivo. pseudolaric acid B can trigger apoptosis by decreasing Bcl-2 levels and activating caspase-3 protease. The future development of PAB as a cancer therapeutic is ongoing. Besides, PAB significantly suppressed proliferation of DU145 cells in a dose-dependent manner without obvious cytotoxicity. PAB may inhibit growth of HRPC DU145 cells and induce apoptosis through ROS generation and Bcl-2 degradation via the activation of the ubiquitin-proteasome pathway.
Supplier | BOC Sciences |
---|---|
Product # | B2703-464428 |
Pricing | 10 mg/unit USD $168 |
Cas | 82508-31-4 |
Molecular Weight | 432.46 |
Molecular Formula | C23H28O8 |
Canonical SMILES | CC(=CC=CC1(C2CCC3(C2(CCC(=CC3)C(=O)OC)OC(=O)C)C(=O)O1)C)C(=O)O |