Desacetyl Diltiazem-[d4]
Desacetyl Diltiazem-[d4] is the labelled analogue of Desacetyl Diltiazem, which is a metabolite of Diltiazem. Diltiazem is a nondihydropyridine calcium channel blocker which can be used in the treatment of hypertension.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012851 |
| Pricing | Inquire |
| Cas | 112259-40-2 |
| Molecular Weight | 376.51 |
| Molecular Formula | C20H20D4N2O3S |
| Canonical SMILES | CN(C)CCN1C2=CC=CC=C2SC(C(C1=O)O)C3=CC=C(C=C3)OC |