Estrone-[2,4,16,16-d4] 3-sulfate sodium salt
Estrone-[2,4,16,16-d4] 3-sulfate sodium salt is the labelled analogue of Estrone 3-sulfate sodium salt, which is a derivative of Estrone. Estrone is one of the three naturally occurring estrogens, the others being estradiol and estriol.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011637 |
| Pricing | Inquire |
| Cas | 285979-80-8 |
| Molecular Weight | 376.44 |
| Molecular Formula | C18H17D4NaO5S |
| Canonical SMILES | CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |