Aurachin D
Aurachin D is a quinoline compound produced by Stigmatella aurantiaca Sg al5. It has the activity of inhibiting gram-positive bacteria and a few yeasts and filamentous fungi, and can block the NADH oxidation of bovine heart microsomal particles.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00132 |
| Pricing | Inquire |
| Cas | 108354-13-8 |
| Molecular Weight | 363.53 |
| Molecular Formula | C25H33NO |
| Canonical SMILES | CC1=C(C(=O)C2=CC=CC=C2N1)CC=C(C)CCC=C(C)CCC=C(C)C |