4-Desisopropyl-4-ethyl Nateglinide-[d5]
4-Desisopropyl-4-ethyl Nateglinide-[d5] is the labelled analogue of 4-Desisopropyl-4-ethyl Nateglinide. 4-Desisopropyl-4-ethyl Nateglinide is an impurity of Nateglinide, which is an insulin secretagog agent that lowers blood glucose levels by stimulating insulin secretion from the pancreas.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002878 |
| Pricing | Inquire |
| Cas | 1356011-67-0 |
| Molecular Weight | 308.43 |
| Molecular Formula | C18H20D5NO3 |
| Canonical SMILES | CCC1CCC(CC1)C(=O)NC(CC2=CC=CC=C2)C(=O)O |