Sucrose-6-phosphate sodium
Sucrose-6-phosphate sodium, an exquisite biomedicine wonder, emerges as a paramount therapeutic resource for a myriad of entangled metabolic intricacies and scarce hereditary ailments. Displaying its virtuosity as a pivotal participant within the glycolytic pathway, this enigmatic marvel bestows profound energy sustenance. Harvested from sucrose, it unveils boundless therapeutic potentials, granting respite to those grappling with glycogen storage maladies, fructose intolerance, and sundry metabolic aberrations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 22372-29-8 |
| Pricing | Inquire |
| Cas | 22372-29-8 |
| Molecular Weight | 422.28 |
| Molecular Formula | C12H23O14P |
| Canonical SMILES | C(C1C(C(C(O1)(CO)OC2C(C(C(C(O2)COP(=O)(O)O)O)O)O)O)O)O |