Cimetidine EP Impurity B
Cimetidine EP Impurity B is an impurity of Cimetidine, a pharmacological agent categorized under the esteemed H2-receptor antagonist lineage. The paramount significance of Cimetidine lies in its prescription dominion, predominantly directed towards efficaciously treating ailments encompassing gastroesophageal reflux maladies, peptic ulcers and analogous afflictions permeating the gastrointestinal domain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138035-55-9 |
| Pricing | Inquire |
| Cas | 138035-55-9 |
| Molecular Weight | 253.32 |
| Molecular Formula | C10H15N5OS |
| Canonical SMILES | CC1=C(N=CN1)CSCCN=C(NC#N)OC |