4-[1-Chloro-2-(methylamino)ethyl]phenyl Acetate Hydrochloride
CpdA is a non-steroidal selective glucocorticoid receptor modulator. It can inhibit the dimerization of glucocorticoid receptor, which prevents transcription of gene targets such as NF-κB and subsequent cytokines through transrepression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14593-25-0 |
| Pricing | Inquire |
| Cas | 14593-25-0 |
| Molecular Weight | 264.15 |
| Molecular Formula | C11H15Cl2NO2 |
| Canonical SMILES | CC(=O)OC1=CC=C(C=C1)C(CNC)Cl.Cl |