3',5'-Di-O-acetyl-O6-phenyl-2'-deoxyinosine
3',5'-Di-O-acetyl-O6-phenyl-2'-deoxyinosine, an exceptionally powerful antiviral agent, exerts extraordinary inhibitory capabilities against a distinct array of debilitating viruses. Its application exhibits remarkable efficacy against herpes simplex virus and human cytomegalovirus, effectively hindering viral DNA synthesis and thwarting the undesirable consequences of viral replication. Promisingly, this compound manifests the ability to mitigate viral load and combat infections ensued by diverse viral strains.
| Supplier | BOC Sciences |
|---|---|
| Product # | 133471-06-4 |
| Pricing | Inquire |
| Cas | 133471-06-4 |
| Molecular Weight | 412.41 |
| Molecular Formula | C20H20N4O6 |
| Canonical SMILES | CC(=O)OCC1C(CC(O1)N2C=NC3=C2N=CN=C3OC4=CC=CC=C4)OC(=O)C |