(Z)-2-(2-Tritylaminothiazol-4-yl)-2-methoxyiminoacetic acid
(Z)-2-(2-Tritylaminothiazol-4-yl)-2-methoxyiminoacetic acid is a highly effective and cutting-edge compound, holding immense potential in studying a wide spectrum of malignant neoplasms. Its remarkable anti-proliferative attributes are attributed to its profound ability to selectively target key proteins intricately associated with the aberrant proliferation of cancerous cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64485-90-1 |
| Pricing | Inquire |
| Cas | 64485-90-1 |
| Molecular Weight | 443.52 |
| Molecular Formula | C25H21N3O3S |
| Canonical SMILES | CON=C(C1=CSC(=N1)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |