CLIP 86-100 acetate
CLIP (86-100) is the 86-100 amino acid fragment of class II-associated invariant chain peptide (CLIP). CLIP is a small self-peptide and cleavage product of the invariant chain in the HLA-II antigen binding slots, which is considered to play a key role in the assembly and transport of MHC class II alphabetaII complexes by interacting with the binding sites of class II peptides.
Supplier | BOC Sciences |
---|---|
Product # | BAT-016137 |
Pricing | Inquire |
Molecular Weight | 1734.17 |
Molecular Formula | C74H132N20O21S3 |
Canonical SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCSC)C(=O)NC(CCC(=O)N)C(=O)NC(C)C(=O)O)NC(=O)C1CCCN1C(=O)C(C(C)O)NC(=O)C(C)NC(=O)C(CCSC)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCSC)NC(=O)C(CCCCN)NC(=O)C(CO)NC(=O)C(C(C)C)NC(=O)C2CCCN2.CC(=O)O |