9-Amino-1,2,3,4-tetrahydroacridin-1-ol-[d3]
Labelled 9-Amino-1,2,3,4-tetrahydroacridin-1-ol. A potential Alzheimer's Disease therapeutic of low toxicity. Exhibits biochemical and pharmacological profile similar to THA except that it is far less toxic and without measurable liver toxicity in humans.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003158 |
| Pricing | Inquire |
| Cas | 1219806-47-9 |
| Molecular Weight | 217.28 |
| Molecular Formula | C13H11D3N2O |
| Canonical SMILES | C1CC(C2=C(C3=CC=CC=C3N=C2C1)N)O |