(+/-)-4'-Hydroxy Propranolol Sulfate-[d7]
(+/-)-4'-Hydroxy Propranolol Sulfate-[d7] is the labelled analogue of (+/-)-4'-Hydroxy Propranolol Sulfate, which is a metabolite of Propranolol. Propranolol is a Beta 1 adrenergic receptor antagonist and could be used for the treatment of high blood pressure, irregular heart rate, thyrotoxicosis, capillary hemangiomas, performance anxiety and essential tremors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-008209 |
| Pricing | Inquire |
| Cas | 1189993-66-5 |
| Molecular Weight | 362.45 |
| Molecular Formula | C16H14D7NO6S |
| Canonical SMILES | CC(C)NCC(COC1=CC=C(C2=CC=CC=C21)OS(=O)(=O)O)O |