Melatonin-[d3]
Melatonin-[d3] is the labelled analogue of Melatonin, which is a hormone produced in the brain by the pineal gland from the amino acid tryptophan. It can be used as an antioxidant and a central nervous system inhibitor. Melatonin is involved in many biological functions such as circadian rhythm, sleep, the stress response, aging, and immunity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004666 |
| Pricing | Inquire |
| Cas | 60418-64-6 |
| Molecular Weight | 235.30 |
| Molecular Formula | C13H13D3N2O2 |
| Canonical SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |