2',3',5'-Tri-O-(t-butyldimethylsilyl)-4'-C-hydroxymethyluridine
2',3',5'-Tri-O-(t-butyldimethylsilyl)-4'-C-hydroxymethyluridine is a highly modified nucleoside characterized by its frequent use in RNA synthesis. Acting as a substrate for RNA polymerases, its presence ensures the efficient addition of other nucleotides, ultimately leading to the formation of RNA target sequences. This unique compound also has the added benefit of offering insight into the effects of nucleoside modifications on RNA's biological structure and function.
Supplier | BOC Sciences |
---|---|
Product # | 232588-97-5 |
Pricing | Inquire |
Cas | 232588-97-5 |
Molecular Weight | 617.01 |
Molecular Formula | C28H56N2O7Si3 |
Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1(C(C(C(O1)N2C=CC(=O)NC2=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO |