Sulfo-Cyanine5 carboxylic acid
Non-activated sulfo-Cyanine5 carboxylic acid, water soluble dye. This dye is highly hydrophilic and water-soluble. Non-sulfonated analog is available. The fluorophore is an equivalent of Cy5® carboxylic acid.For labeling applications consider using pre-activated sulfo-Cy5 NHS ester
| Supplier | BOC Sciences |
|---|---|
| Product # | F03-0007 |
| Pricing | Inquire |
| Cas | 1144107-82-3 |
| Molecular Weight | 680,87 |
| Molecular Formula | C32H37N2KO8S2 |
| Canonical SMILES | CC1(C2=C(C=CC(=C2)S(=O)(=O)[O-])[N+](=C1C=CC=CC=C3C(C4=C(N3CCCCCC(=O)O)C=CC(=C4)S(=O)(=O)[O-])(C)C)C)C.[K+] |