Amoxicillin-[d4]
Labelled Amoxicillin. Amoxicillin is a moderate-spectrum, bacteriolytic, β-lactam antibiotic used to treat bacterial infections caused by susceptible microorganisms. It is usually the drug of choice within the class because it is better-absorbed, following oral administration, than other β-lactam antibiotics. Amoxicillin is susceptible to degradation by β-lactamase-producing bacteria, which are resistant to a narrow spectrum of β-lactam antibiotics, such as penicillin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003304 |
| Pricing | Inquire |
| Cas | 2673270-36-3 |
| Molecular Weight | 369.43 |
| Molecular Formula | C16H15D4N3O5S |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)C(=O)O)C |