Terminolic acid
Terminolic acid, a pentacyclic triterpenoid glycoside isolated from Combretum racemosum, inhibits pro-inflammatory cytokines by binding to the receptor active sites of IL-1β and IL-6, and enhances anti-inflammatory cytokines by binding to IL-4 receptor binding sites. It also shows moderate antibacterial activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-380150 |
| Pricing | Inquire |
| Cas | 564-13-6 |
| Molecular Weight | 504.70 |
| Molecular Formula | C30H48O6 |
| Canonical SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CC(C5C4(CC(C(C5(C)CO)O)O)C)O)C)C2C1)C)C(=O)O)C |