b-Estradiol 17-(b-D-glucuronide) sodium salt
b-Estradiol 17-(b-D-glucuronide) sodium salt is a pharmaceutical compound used in the biomedical industry. It serves as a prodrug of b-Estradiol, a hormone used in hormone replacement therapy and in the treatment of symptoms associated with menopause. This sodium salt form enhances its solubility and stability for various applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15087-02-2 |
| Pricing | Inquire |
| Cas | 15087-02-2 |
| Molecular Weight | 470.49 |
| Molecular Formula | C24H31O8Na |
| Canonical SMILES | CC12CCC3C(C1CCC2OC4C(C(C(C(O4)C(=O)[O-])O)O)O)CCC5=C3C=CC(=C5)O.[Na+] |