N-(β-D-glucopyranosyl)triphenyl-phosphine imide
N-(β-D-glucopyranosyl)triphenyl-phosphine imide, a chemical compound with intriguing potential, has garnered significant interest in the medical industry to treat complex diseases like cancer and diabetes. Its composition’s unique nature enables it to be utilized for targeted pharmaceutical delivery and enhanced efficacy. Preliminary testing in preclinical studies displays remarkably encouraging results. As such, this compound proves to be a promising candidate for further investigations in its therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100639-11-0 |
| Pricing | Inquire |
| Cas | 100639-11-0 |
| Molecular Weight | 439.44 |
| Molecular Formula | C24H26NO5P |
| Canonical SMILES | C1=CC=C(C=C1)P(=NC2C(C(C(C(O2)CO)O)O)O)(C3=CC=CC=C3)C4=CC=CC=C4 |